Difference between revisions of "CHC T00008904001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FECOSTEROL FECOSTEROL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2...")
 
(Created page with "Category:Gene == Gene CHC_T00008904001_1 == * Synonym(s): == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-arabidopsis_thaliana == Pathways as...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FECOSTEROL FECOSTEROL] ==
+
== Gene CHC_T00008904001_1 ==
* smiles:
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34))))
+
* inchi key:
+
** InChIKey=SLQKYSPHBZMASJ-QKPORZECSA-N
+
* common name:
+
** fecosterol
+
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
** 24-methylene-5α-cholest-8-en-3β-ol
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN3O-203]]
+
* Reaction: [[RXN-8443]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-arabidopsis_thaliana]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMST01030095
+
{{#set: reaction associated=RXN-8443}}
* PUBCHEM:
+
{{#set: pathway associated=PWY-5381}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440371 440371]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17038 17038]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04525 C04525]
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=SLQKYSPHBZMASJ-QKPORZECSA-N}}
+
{{#set: common name=fecosterol}}
+
{{#set: molecular weight=398.671    }}
+
{{#set: common name=24-methylene-5α-cholest-8-en-3β-ol}}
+
{{#set: consumed by=RXN3O-203}}
+

Latest revision as of 14:58, 23 May 2018

Gene CHC_T00008904001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links