Difference between revisions of "CPD-19163"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mature-tRNA mature-tRNA] == * common name: ** mature tRNA * Synonym(s): == Reaction(s) known t...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mature-tRNA mature-tRNA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] ==
 +
* smiles:
 +
** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* molecular weight:
 +
** 1025.937   
 +
* inchi key:
 +
** InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J
 
* common name:
 
* common name:
** mature tRNA
+
** (2E,11Z)-octadecenoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** 18:2-Δ2,Δ11-CoA
 +
** 2-trans,11-cis-octadecenoyl-CoA
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17785]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.26.11-RXN]]
+
* [[RXN-17784]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=mature tRNA}}
+
{{#set: smiles=CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: produced by=3.1.26.11-RXN}}
+
{{#set: molecular weight=1025.937    }}
 +
{{#set: inchi key=InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J}}
 +
{{#set: common name=(2E,11Z)-octadecenoyl-CoA}}
 +
{{#set: common name=18:2-Δ2,Δ11-CoA|2-trans,11-cis-octadecenoyl-CoA}}
 +
{{#set: consumed by=RXN-17785}}
 +
{{#set: produced by=RXN-17784}}

Latest revision as of 15:21, 9 January 2019

Metabolite CPD-19163

  • smiles:
    • CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 1025.937
  • inchi key:
    • InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J
  • common name:
    • (2E,11Z)-octadecenoyl-CoA
  • Synonym(s):
    • 18:2-Δ2,Δ11-CoA
    • 2-trans,11-cis-octadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.