Difference between revisions of "PWY-7470"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8846 CPD-8846] == * smiles: ** C=CC=C(CCC=C(CCC=C(C)C)C)C * common name: ** 4,8,12-trimethy...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7470 PWY-7470] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** phosphatidylcholine biosynthesis VII |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[ | + | * [[2.3.1.23-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[CHC_T00007447001_1]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15380 RXN-15380] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=phosphatidylcholine biosynthesis VII}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:22, 9 January 2019
Pathway PWY-7470
- common name:
- phosphatidylcholine biosynthesis VII
- taxonomic range:
- Synonym(s):
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- 2.3.1.23-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
