Difference between revisions of "PWY-5538"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] == * smiles: ** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5538 PWY-5538] ==
* smiles:
+
** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))
+
* inchi key:
+
** InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N
+
 
* common name:
 
* common name:
** 7-dehydrocholesterol
+
** pyruvate fermentation to acetate VI
* molecular weight:
+
* taxonomic range:
** 384.644   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-5719 TAX-5719]
 
* Synonym(s):
 
* Synonym(s):
** cholesta-5,7-dien-3 β-ol
+
** acetate fermentation
** cholesta-5,7-dienol
+
** 7-dehydro-cholesterol
+
** cholesta-5,7-dien-3β-ol
+
** provitamin D3
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''4''' reactions in the full pathway
* [[1.14.21.6-RXN]]
+
* [[PYRUFLAVREDUCT-RXN]]
== Reaction(s) of unknown directionality ==
+
** 9 associated gene(s):
 +
*** [[CHC_T00008442001_1]]
 +
*** [[CHC_T00003376001_1]]
 +
*** [[CHC_T00001730001_1]]
 +
*** [[CHC_T00001454001_1]]
 +
*** [[CHC_T00003402001_1]]
 +
*** [[CHC_T00000866001_1]]
 +
*** [[CHC_T00009061001_1]]
 +
*** [[CHC_T00008758001_1]]
 +
*** [[CHC_T00000865001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[SUCCCOASYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009212001_1]]
 +
*** [[CHC_T00008602001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5536 PWY-5536]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5536 PWY-5536]
 
== External links  ==
 
== External links  ==
* CAS : 434-16-2
+
{{#set: common name=pyruvate fermentation to acetate VI}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439423 439423]
+
{{#set: taxonomic range=TAX-5719}}
* CHEBI:
+
{{#set: common name=acetate fermentation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17759 17759]
+
{{#set: reaction found=2}}
* LIGAND-CPD:
+
{{#set: total reaction=4}}
** [http://www.genome.jp/dbget-bin/www_bget?C01164 C01164]
+
{{#set: completion rate=50.0}}
* HMDB : HMDB00032
+
{{#set: smiles=CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))}}
+
{{#set: inchi key=InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N}}
+
{{#set: common name=7-dehydrocholesterol}}
+
{{#set: molecular weight=384.644    }}
+
{{#set: common name=cholesta-5,7-dien-3 β-ol|cholesta-5,7-dienol|7-dehydro-cholesterol|cholesta-5,7-dien-3β-ol|provitamin D3}}
+
{{#set: produced by=1.14.21.6-RXN}}
+

Latest revision as of 15:22, 9 January 2019

Pathway PWY-5538

  • common name:
    • pyruvate fermentation to acetate VI
  • taxonomic range:
  • Synonym(s):
    • acetate fermentation

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links