Difference between revisions of "5Z8Z11Z14Z17Z-EICOSAPENTAENOATE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009336001 == * left end position: ** 328046 * transcription direction: ** NEGATIVE * right end position: ** 329128 * centisome position: ** 74...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z14Z17Z-EICOSAPENTAENOATE 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-] |
| − | * | + | * molecular weight: |
| − | ** | + | ** 301.448 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M |
| − | * | + | * common name: |
| − | ** | + | ** icosapentaenoate |
* Synonym(s): | * Synonym(s): | ||
| + | ** (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate | ||
| + | ** timnodonic acid | ||
| + | ** (5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate | ||
| + | ** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid | ||
| + | ** EPA | ||
| + | ** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate | ||
| + | ** eicosapentaenoate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-12978]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58562 58562] |
| − | {{#set: | + | * Wikipedia : Eicosapentaenoate |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245749 25245749] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C06428 C06428] | ||
| + | * HMDB : HMDB01999 | ||
| + | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-]}} | ||
| + | {{#set: molecular weight=301.448 }} | ||
| + | {{#set: inchi key=InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M}} | ||
| + | {{#set: common name=icosapentaenoate}} | ||
| + | {{#set: common name=(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate|timnodonic acid|(5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate|(5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid|EPA|(5Z,8Z,11Z,14Z,17Z)-icosapentaenoate|eicosapentaenoate}} | ||
| + | {{#set: consumed by=RXN-12978}} | ||
Latest revision as of 15:23, 9 January 2019
Contents
Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-]
- molecular weight:
- 301.448
- inchi key:
- InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M
- common name:
- icosapentaenoate
- Synonym(s):
- (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate
- timnodonic acid
- (5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate
- (5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid
- EPA
- (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate
- eicosapentaenoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-" cannot be used as a page name in this wiki.
