Difference between revisions of "Leader-Sequences"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == * smiles: ** C(NC(=O)C(CSC=O)NC(=O)CCC([N+])C(=O)[O-])C(=O)[O-] * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Leader-Sequences Leader-Sequences] == * common name: ** a leader sequence * Synonym(s): == Rea...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Leader-Sequences Leader-Sequences] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a leader sequence |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[3.4.21.89-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=a leader sequence}} | |
− | + | {{#set: produced by=3.4.21.89-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 16:06, 23 May 2018
Contents
Metabolite Leader-Sequences
- common name:
- a leader sequence
- Synonym(s):