Difference between revisions of "NAD-BIOSYNTHESIS-II"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) * inchi key: **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=NAD-BIOSYNTHESIS-II NAD-BIOSYNTHESIS-II] ==
−
* smiles:
+
−
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
+
−
* inchi key:
+
−
** InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L
+
 
* common name:
 
* common name:
−
** 1D-myo-inositol 5-monophosphate
+
** NAD salvage pathway III
−
* molecular weight:
+
* taxonomic range:
−
** 258.121   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
−
** D-myo-inositol 5-monophosphate
+
** nicotinamide adenine dinucleotide salvage
−
** Ins(5)P1
+
−
** 1D-myo-inositol 5-phosphate
+
−
** Ins(5)P
+
−
** Ins5P
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-10953]]
+
'''3''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[NADPYROPHOSPHAT-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00000276001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN-5822]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00000494001_1]]
 +
*** [[CHC_T00005741001_1]]
 +
*** [[CHC_T00002031001_1]]
 +
*** [[CHC_T00001956001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-5841]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00008300001_1]]
 +
*** [[CHC_T00000267001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-4106 PWY3O-4106]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-4106 PWY3O-4106]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
+
* ECOCYC:
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L}}
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=NAD-BIOSYNTHESIS-II NAD-BIOSYNTHESIS-II]
−
{{#set: common name=1D-myo-inositol 5-monophosphate}}
+
{{#set: common name=NAD salvage pathway III}}
−
{{#set: molecular weight=258.121    }}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: common name=D-myo-inositol 5-monophosphate|Ins(5)P1|1D-myo-inositol 5-phosphate|Ins(5)P|Ins5P}}
+
{{#set: common name=nicotinamide adenine dinucleotide salvage}}
−
{{#set: consumed by=RXN-10953}}
+
{{#set: reaction found=3}}
 +
{{#set: total reaction=5}}
 +
{{#set: completion rate=60.0}}

Latest revision as of 15:24, 9 January 2019

Pathway NAD-BIOSYNTHESIS-II

  • common name:
    • NAD salvage pathway III
  • taxonomic range:
  • Synonym(s):
    • nicotinamide adenine dinucleotide salvage

Reaction(s) found

3 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=NAD-BIOSYNTHESIS-II&oldid=20251"