Difference between revisions of "RXN-17010"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi k...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17010 RXN-17010] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** Lysophosphatidic acid acyltransferase |
− | * | + | ** 1-acyl-sn-glycerol-3-phosphate acyltransferase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-18346]][c] '''+''' 1 [[1-PALMITOYLGLYCEROL-3-PHOSPHATE]][c] '''=>''' 1 [[CPD-18352]][c] '''+''' 1 [[CO-A]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 cis-vaccenoyl-CoA[c] '''+''' 1 1-palmitoylglycerol 3-phosphate[c] '''=>''' 1 1-palmitoyl-2-cis-vaccenoyl phosphatidate[c] '''+''' 1 coenzyme A[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | == | + | * Gene: [[CHC_T00008526001]] |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: AUTOMATED-NAME-MATCH |
+ | * Gene: [[CHC_T00008713001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[CHC_T00009195001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[CHC_T00009396001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[CHC_T00008713001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00008325001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[CHC_T00009396001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Lysophosphatidic acid acyltransferase}} | |
− | + | {{#set: common name=1-acyl-sn-glycerol-3-phosphate acyltransferase}} | |
− | + | {{#set: ec number=EC-2.3.1.51}} | |
− | + | {{#set: gene associated=CHC_T00008526001|CHC_T00008713001|CHC_T00009195001|CHC_T00009396001|CHC_T00008713001_1|CHC_T00008325001|CHC_T00009396001_1}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-ectocarpus_siliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:31, 9 January 2019
Contents
Reaction RXN-17010
- direction:
- LEFT-TO-RIGHT
- common name:
- Lysophosphatidic acid acyltransferase
- 1-acyl-sn-glycerol-3-phosphate acyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-18346[c] + 1 1-PALMITOYLGLYCEROL-3-PHOSPHATE[c] => 1 CPD-18352[c] + 1 CO-A[c]
- With common name(s):
- 1 cis-vaccenoyl-CoA[c] + 1 1-palmitoylglycerol 3-phosphate[c] => 1 1-palmitoyl-2-cis-vaccenoyl phosphatidate[c] + 1 coenzyme A[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008526001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00008713001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00009195001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00009396001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00008713001_1
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00008325001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00009396001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome