Difference between revisions of "O-SUCCINYL-L-HOMOSERINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15513 RXN-15513] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/5.4...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15513 RXN-15513] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/5.4.2.11 EC-5.4.2.11]
+
** 218.186   
 +
* inchi key:
 +
** InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M
 +
* common name:
 +
** O-succinyl-L-homoserine
 
* Synonym(s):
 
* Synonym(s):
 +
** O-succinyl-homoserine
 +
** succinyl-homoserine
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[METBALT-RXN]]
** 1 [[2-PG]][c] '''<=>''' 1 [[G3P]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[HOMSUCTRAN-RXN]]
** 1 2-phospho-D-glycerate[c] '''<=>''' 1 3-phospho-D-glycerate[c]
+
== Reaction(s) of unknown directionality ==
 
+
* [[O-SUCCHOMOSERLYASE-RXN]]
== Genes associated with this reaction  ==
+
* [[RXN-9384]]
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00001519001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00004201001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00001241001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00000449001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00007707001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
* [[PWY-1622]], formaldehyde assimilation I (serine pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1622 PWY-1622]
+
** '''6''' reactions found over '''13''' reactions in the full pathway
+
* [[GLYCOLYSIS]], glycolysis I (from glucose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS GLYCOLYSIS]
+
** '''12''' reactions found over '''12''' reactions in the full pathway
+
* [[ANAGLYCOLYSIS-PWY]], glycolysis III (from glucose): [http://metacyc.org/META/NEW-IMAGE?object=ANAGLYCOLYSIS-PWY ANAGLYCOLYSIS-PWY]
+
** '''10''' reactions found over '''10''' reactions in the full pathway
+
* [[PWY-5484]], glycolysis II (from fructose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5484 PWY-5484]
+
** '''11''' reactions found over '''11''' reactions in the full pathway
+
* [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
+
** '''15''' reactions found over '''18''' reactions in the full pathway
+
* [[PWY66-399]], gluconeogenesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-399 PWY66-399]
+
** '''9''' reactions found over '''12''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=REVERSIBLE}}
+
* CHEBI:
{{#set: ec number=EC-5.4.2.11}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57661 57661]
{{#set: gene associated=CHC_T00001519001_1|CHC_T00004201001_1|CHC_T00001241001_1|CHC_T00000449001_1|CHC_T00007707001_1}}
+
* CAS : 1492-23-5
{{#set: in pathway=PWY-1622|GLYCOLYSIS|ANAGLYCOLYSIS-PWY|PWY-5484|P122-PWY|PWY66-399}}
+
* BIGG : suchms
{{#set: reconstruction category=orthology}}
+
* PUBCHEM:
{{#set: reconstruction tool=pantograph}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878420 46878420]
{{#set: reconstruction source=galdieria.sulphuraria}}
+
* LIGAND-CPD:
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01118 C01118]
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O}}
{{#set: reconstruction source=original_genome}}
+
{{#set: molecular weight=218.186    }}
 +
{{#set: inchi key=InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M}}
 +
{{#set: common name=O-succinyl-L-homoserine}}
 +
{{#set: common name=O-succinyl-homoserine|succinyl-homoserine}}
 +
{{#set: consumed by=METBALT-RXN}}
 +
{{#set: produced by=HOMSUCTRAN-RXN}}
 +
{{#set: reversible reaction associated=O-SUCCHOMOSERLYASE-RXN|RXN-9384}}

Latest revision as of 16:28, 9 January 2019

Metabolite O-SUCCINYL-L-HOMOSERINE

  • smiles:
    • C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O
  • molecular weight:
    • 218.186
  • inchi key:
    • InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M
  • common name:
    • O-succinyl-L-homoserine
  • Synonym(s):
    • O-succinyl-homoserine
    • succinyl-homoserine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O" cannot be used as a page name in this wiki.