Difference between revisions of "CPD-3945"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008530001 == * left end position: ** 194308 * transcription direction: ** POSITIVE * right end position: ** 196347 * centisome position: ** 31...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3945 CPD-3945] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
− | * | + | * molecular weight: |
− | ** | + | ** 414.67 |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N |
− | * | + | * common name: |
− | ** | + | ** (22α)-hydroxy-campest-4-en-3-one |
* Synonym(s): | * Synonym(s): | ||
+ | ** (22S)-22-hydroxy-campest-4-en-3-one | ||
+ | ** (22S,24R)-22-hydroxy-ergost-4-en-3-one | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-4231]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72330 72330] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15341631 15341631] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15796 C15796] |
+ | * LIPID_MAPS : LMST01031116 | ||
+ | * HMDB : HMDB12113 | ||
+ | {{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: molecular weight=414.67 }} | ||
+ | {{#set: inchi key=InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N}} | ||
+ | {{#set: common name=(22α)-hydroxy-campest-4-en-3-one}} | ||
+ | {{#set: common name=(22S)-22-hydroxy-campest-4-en-3-one|(22S,24R)-22-hydroxy-ergost-4-en-3-one}} | ||
+ | {{#set: produced by=RXN-4231}} |
Latest revision as of 15:29, 9 January 2019
Contents
Metabolite CPD-3945
- smiles:
- CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
- molecular weight:
- 414.67
- inchi key:
- InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N
- common name:
- (22α)-hydroxy-campest-4-en-3-one
- Synonym(s):
- (22S)-22-hydroxy-campest-4-en-3-one
- (22S,24R)-22-hydroxy-ergost-4-en-3-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.