Difference between revisions of "CPD-15692"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00002427001_1 == * Synonym(s): == Reactions associated == * DUTP-PYROP-RXN ** pantograph-galdieria.sulphuraria == Pathways associat...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00002427001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15692 CPD-15692] ==
 +
* smiles:
 +
** CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* molecular weight:
 +
** 915.738   
 +
* inchi key:
 +
** InChIKey=CQGVNMQHZQJNII-ZJZQAHHTSA-J
 +
* common name:
 +
** 3-trans-decenoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** 3E-decenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[DUTP-PYROP-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[RXN-14803]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-7206]]
+
* [[PWY-7184]]
+
* [[PWY-7187]]
+
* [[PWY-6545]]
+
* [[PWY0-166]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=DUTP-PYROP-RXN}}
+
* CHEBI:
{{#set: pathway associated=PWY-7206|PWY-7184|PWY-7187|PWY-6545|PWY0-166}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84793 84793]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657610 90657610]
 +
{{#set: smiles=CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: molecular weight=915.738    }}
 +
{{#set: inchi key=InChIKey=CQGVNMQHZQJNII-ZJZQAHHTSA-J}}
 +
{{#set: common name=3-trans-decenoyl-CoA}}
 +
{{#set: common name=3E-decenoyl-CoA}}
 +
{{#set: produced by=RXN-14803}}

Latest revision as of 15:31, 9 January 2019

Metabolite CPD-15692

  • smiles:
    • CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 915.738
  • inchi key:
    • InChIKey=CQGVNMQHZQJNII-ZJZQAHHTSA-J
  • common name:
    • 3-trans-decenoyl-CoA
  • Synonym(s):
    • 3E-decenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.