Difference between revisions of "GUANOSINE-5DP-3DP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-myristoyl-ACPs 3-oxo-myristoyl-ACPs] == * common name: ** a 3-oxo-myristoyl-[acp] * Synon...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] == |
+ | * smiles: | ||
+ | ** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) | ||
+ | * molecular weight: | ||
+ | ** 598.123 | ||
+ | * inchi key: | ||
+ | ** InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I | ||
* common name: | * common name: | ||
− | ** | + | ** ppGpp |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** guanosine tetraphosphate |
− | ** | + | ** guanosine 5'-diphosphate,3'-diphosphate |
− | ** | + | ** guanosine 3',5'-bispyrophosphate |
+ | ** guanosine 3',5'-bis(diphosphate) | ||
+ | ** guanosine 3'-diphosphate 5'-diphosphate | ||
+ | ** magic spot | ||
+ | ** guanosine-5',3'-tetraphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[PPGPPSYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : ppgpp |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: consumed by= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01228 C01228] |
− | + | * HMDB : HMDB59638 | |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.13082026.html 13082026] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77828 77828] | ||
+ | * DRUGBANK : DB04022 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15938967 15938967] | ||
+ | {{#set: smiles=C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} | ||
+ | {{#set: molecular weight=598.123 }} | ||
+ | {{#set: inchi key=InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I}} | ||
+ | {{#set: common name=ppGpp}} | ||
+ | {{#set: common name=guanosine tetraphosphate|guanosine 5'-diphosphate,3'-diphosphate|guanosine 3',5'-bispyrophosphate|guanosine 3',5'-bis(diphosphate)|guanosine 3'-diphosphate 5'-diphosphate|magic spot|guanosine-5',3'-tetraphosphate}} | ||
+ | {{#set: consumed by=PPGPPSYN-RXN}} |
Latest revision as of 15:34, 9 January 2019
Contents
Metabolite GUANOSINE-5DP-3DP
- smiles:
- C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- molecular weight:
- 598.123
- inchi key:
- InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I
- common name:
- ppGpp
- Synonym(s):
- guanosine tetraphosphate
- guanosine 5'-diphosphate,3'-diphosphate
- guanosine 3',5'-bispyrophosphate
- guanosine 3',5'-bis(diphosphate)
- guanosine 3'-diphosphate 5'-diphosphate
- magic spot
- guanosine-5',3'-tetraphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : ppgpp
- LIGAND-CPD:
- HMDB : HMDB59638
- CHEMSPIDER:
- CHEBI:
- DRUGBANK : DB04022
- PUBCHEM:
"C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.