Difference between revisions of "CHC T00008389001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GMP GMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inch...") |
(Created page with "Category:Gene == Gene CHC_T00008389001_1 == * Synonym(s): == Reactions associated == * Reaction: PROTEIN-KINASE-RXN ** Source: orthology-ectocarpus_siliculosus *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008389001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | * | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | + | * Reaction: [[RXN-8443]] | |
− | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | + | == Pathways associated == | |
− | * [[RXN- | + | * [[PWY-5381]] |
− | * | + | |
− | * [[ | + | |
− | == | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN|RXN-8443}} | |
− | + | {{#set: pathway associated=PWY-5381}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 15:10, 23 May 2018
Gene CHC_T00008389001_1
- Synonym(s):
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-8443
- Source: orthology-ectocarpus_siliculosus