Difference between revisions of "CPD-7417"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008525001_1 == * Synonym(s): == Reactions associated == * SULFITE-REDUCTASE-FERREDOXIN-RXN ** pantograph-galdieria.sulphuraria **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008525001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] ==
 +
* smiles:
 +
** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O
 +
* molecular weight:
 +
** 325.294   
 +
* inchi key:
 +
** InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M
 +
* common name:
 +
** cis-coumarinic acid-β-D-glucoside
 
* Synonym(s):
 
* Synonym(s):
 +
** coumarinic acid glucoside
 +
** coumarinate glucoside
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[SULFITE-REDUCTASE-FERREDOXIN-RXN]]
+
* [[RXN-8036]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[a.taliana]]
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[SULFMETII-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=SULFITE-REDUCTASE-FERREDOXIN-RXN}}
+
* CHEBI:
{{#set: pathway associated=SULFMETII-PWY}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62223 62223]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796113 25796113]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05839 C05839]
 +
* HMDB : HMDB60077
 +
{{#set: smiles=C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O}}
 +
{{#set: molecular weight=325.294    }}
 +
{{#set: inchi key=InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M}}
 +
{{#set: common name=cis-coumarinic acid-β-D-glucoside}}
 +
{{#set: common name=coumarinic acid glucoside|coumarinate glucoside}}
 +
{{#set: consumed by=RXN-8036}}

Latest revision as of 15:37, 9 January 2019

Metabolite CPD-7417

  • smiles:
    • C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O
  • molecular weight:
    • 325.294
  • inchi key:
    • InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M
  • common name:
    • cis-coumarinic acid-β-D-glucoside
  • Synonym(s):
    • coumarinic acid glucoside
    • coumarinate glucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O" cannot be used as a page name in this wiki.