Difference between revisions of "PWY-6607"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * smiles: ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=ODKSFYDXXFIFQ...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6607 PWY-6607] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** guanosine nucleotides degradation I |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''2''' reactions found over '''4''' reactions in the full pathway |
− | * [[ | + | * [[RXN-7609]] |
− | + | ** 2 associated gene(s): | |
− | + | *** [[CHC_T00008300001_1]] | |
− | * [[ | + | *** [[CHC_T00000267001_1]] |
− | * [[ | + | ** 3 reconstruction source(s) associated: |
− | * [ | + | *** [[orthology-galdieria.sulphuraria]] |
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RXN0-901]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[CHC_T00006216001_1]] | ||
+ | *** [[CHC_T00006932001_1]] | ||
+ | *** [[CHC_T00000194001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-DEAMINASE-RXN GUANOSINE-DEAMINASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN0-363 RXN0-363] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=guanosine nucleotides degradation I}} | |
− | + | {{#set: taxonomic range=TAX-3193}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=50.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:30, 9 January 2019
Pathway PWY-6607
- common name:
- guanosine nucleotides degradation I
- taxonomic range:
- Synonym(s):
Reaction(s) found
2 reactions found over 4 reactions in the full pathway
- RXN-7609
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN0-901
- 3 associated gene(s):
- 2 reconstruction source(s) associated: