Difference between revisions of "CPD-18350"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] == * smiles: ** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18350 CPD-18350] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCCCCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCC)COP([O-])(=O)[O-])=O |
+ | * molecular weight: | ||
+ | ** 644.867 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=SCNLPRDASXIFJK-IQULNDIKSA-L |
* common name: | * common name: | ||
− | ** | + | ** 1-palmitoyl-2-palmitoleoyl phosphatidate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 16:0-16:1-PA | ||
+ | ** 1-hexadecanoyl-2-(9Z-hexadecenoyl)-sn-glycerol-3-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-17008]] |
+ | * [[RXN-17012]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515007 102515007] |
− | + | {{#set: smiles=CCCCCCCCCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCC)COP([O-])(=O)[O-])=O}} | |
− | {{#set: smiles= | + | {{#set: molecular weight=644.867 }} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=SCNLPRDASXIFJK-IQULNDIKSA-L}} |
− | {{#set: common name= | + | {{#set: common name=1-palmitoyl-2-palmitoleoyl phosphatidate}} |
− | {{#set: | + | {{#set: common name=16:0-16:1-PA|1-hexadecanoyl-2-(9Z-hexadecenoyl)-sn-glycerol-3-phosphate}} |
− | {{#set: produced by= | + | {{#set: produced by=RXN-17008|RXN-17012}} |
Latest revision as of 16:38, 9 January 2019
Contents
Metabolite CPD-18350
- smiles:
- CCCCCCCCCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCC)COP([O-])(=O)[O-])=O
- molecular weight:
- 644.867
- inchi key:
- InChIKey=SCNLPRDASXIFJK-IQULNDIKSA-L
- common name:
- 1-palmitoyl-2-palmitoleoyl phosphatidate
- Synonym(s):
- 16:0-16:1-PA
- 1-hexadecanoyl-2-(9Z-hexadecenoyl)-sn-glycerol-3-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCCCCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCC)COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.