Difference between revisions of "CPD-12673"

Latest revision as of 16:12, 9 January 2019

"C(=O)([O-])C(O)C(O)C(O)CCl" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Pathway]]
+[[Category:Metabolite]]
-== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5970 PWY-5970] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] ==
-* taxonomic range:
+* smiles:
-** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+** C(=O)([O-])C(O)C(O)C(O)CCl
+* molecular weight:
+** 183.568
+* inchi key:
+** InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M
 * common name:
-** fatty acids biosynthesis (yeast)
+** 5-chloro-5-deoxy-D-ribonate
 * Synonym(s):
-** type I fatty acids biosynthesis
-== Reaction(s) found ==
+== Reaction(s) known to consume the compound ==
-* '''1''' reaction(s) found
+* [[RXN-11717]]
-** [[FATTY-ACYL-COA-SYNTHASE-RXN]]
+== Reaction(s) known to produce the compound ==
-== Reaction(s) not found ==
+== Reaction(s) of unknown directionality ==
-* '''0''' reaction(s) not found
 == External links  ==
-{{#set: taxonomic range=TAX-4751}}
+* PUBCHEM:
-{{#set: common name=fatty acids biosynthesis (yeast)}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859707 49859707]
-{{#set: common name=type I fatty acids biosynthesis}}
+{{#set: smiles=C(=O)([O-])C(O)C(O)C(O)CCl}}
-{{#set: reaction found=1}}
+{{#set: molecular weight=183.568    }}
-{{#set: reaction not found=0}}
+{{#set: inchi key=InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M}}
+{{#set: common name=5-chloro-5-deoxy-D-ribonate}}
+{{#set: consumed by=RXN-11717}}