Difference between revisions of "CPD-3188"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * smiles: ** C1(NC=NC=1CC([CH]=O)[N+]) * inchi key: ** InChIKey=VYOIE...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] == |
* smiles: | * smiles: | ||
| − | ** C1( | + | ** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2)) |
| + | * molecular weight: | ||
| + | ** 192.217 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=GQUFOBHEPVFQMD-VIFPVBQESA-N |
* common name: | * common name: | ||
| − | ** | + | ** N'-hydroxymethyl-norcotinine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN66-169]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201488 25201488] |
| − | + | * HMDB : HMDB01324 | |
| − | + | {{#set: smiles=C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2))}} | |
| − | + | {{#set: molecular weight=192.217 }} | |
| − | + | {{#set: inchi key=InChIKey=GQUFOBHEPVFQMD-VIFPVBQESA-N}} | |
| − | * HMDB : | + | {{#set: common name=N'-hydroxymethyl-norcotinine}} |
| − | {{#set: smiles=C1( | + | {{#set: produced by=RXN66-169}} |
| − | + | ||
| − | + | ||
| − | {{#set: molecular weight= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:41, 9 January 2019
Contents
Metabolite CPD-3188
- smiles:
- C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2))
- molecular weight:
- 192.217
- inchi key:
- InChIKey=GQUFOBHEPVFQMD-VIFPVBQESA-N
- common name:
- N'-hydroxymethyl-norcotinine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB01324
"C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.
