Difference between revisions of "CPD-17050"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_345 == * left end position: ** 49544 * transcription direction: ** POSITIVE * right end position: ** 51340 * common name: ** dnaB * centisome pos...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3) |
| − | * | + | * molecular weight: |
| − | ** | + | ** 296.358 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP | ||
| + | ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-15684]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657891 90657891] |
| − | {{#set: | + | {{#set: smiles=C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)}} |
| − | {{#set: common name= | + | {{#set: molecular weight=296.358 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N}} |
| − | {{#set: | + | {{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}} |
| + | {{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione}} | ||
| + | {{#set: produced by=RXN-15684}} | ||
Latest revision as of 15:42, 9 January 2019
Contents
Metabolite CPD-17050
- smiles:
- C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)
- molecular weight:
- 296.358
- inchi key:
- InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N
- common name:
- 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
- Synonym(s):
- 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP
- 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
