Difference between revisions of "CPD-12129"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5057 PWY-5057] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5057 PWY-5057] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12129 CPD-12129] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
* molecular weight:
 +
** 991.617   
 +
* inchi key:
 +
** InChIKey=FWFJGQGPMZXTLM-WPPIEQSHSA-N
 
* common name:
 
* common name:
** L-valine degradation II
+
** menaquinol-12
 
* Synonym(s):
 
* Synonym(s):
** Ehrlich pathway
+
** MKH2-12
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''3''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[RXN-7657]]
+
* [[RXN-9363]]
** [[RXN-7643]]
+
== Reaction(s) of unknown directionality ==
** [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
+
== Reaction(s) not found ==
+
* '''0''' reaction(s) not found
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2}}
+
* CHEBI:
{{#set: taxonomic range=TAX-4751}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84550 84550]
{{#set: common name=L-valine degradation II}}
+
* PUBCHEM:
{{#set: common name=Ehrlich pathway}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479280 45479280]
{{#set: reaction found=3}}
+
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C}}
{{#set: reaction not found=0}}
+
{{#set: molecular weight=991.617    }}
 +
{{#set: inchi key=InChIKey=FWFJGQGPMZXTLM-WPPIEQSHSA-N}}
 +
{{#set: common name=menaquinol-12}}
 +
{{#set: common name=MKH2-12}}
 +
{{#set: produced by=RXN-9363}}

Latest revision as of 15:44, 9 January 2019

Metabolite CPD-12129

  • smiles:
    • CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C
  • molecular weight:
    • 991.617
  • inchi key:
    • InChIKey=FWFJGQGPMZXTLM-WPPIEQSHSA-N
  • common name:
    • menaquinol-12
  • Synonym(s):
    • MKH2-12

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links