Difference between revisions of "CPD-9903"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-pi-phospho-L-histidines Protein-pi-phospho-L-histidines] == * common name: ** a [protei...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9903 CPD-9903] == |
| + | * smiles: | ||
| + | ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C | ||
| + | * molecular weight: | ||
| + | ** 629.941 | ||
| + | * inchi key: | ||
| + | ** InChIKey=LIEYLSGXGOXYTD-CTBYCIIYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-(3,7,11,15,19,23-heptamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid |
| + | ** 3-heptaprenyl-4,5-dihydroxybenzoate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-9287]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84450 84450] |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740353 54740353] | ||
| + | {{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C}} | ||
| + | {{#set: molecular weight=629.941 }} | ||
| + | {{#set: inchi key=InChIKey=LIEYLSGXGOXYTD-CTBYCIIYSA-M}} | ||
| + | {{#set: common name=3,4-dihydroxy-5-all-trans-heptaprenylbenzoate}} | ||
| + | {{#set: common name=3-(3,7,11,15,19,23-heptamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid|3-heptaprenyl-4,5-dihydroxybenzoate}} | ||
| + | {{#set: consumed by=RXN-9287}} | ||
Latest revision as of 15:45, 9 January 2019
Contents
Metabolite CPD-9903
- smiles:
- CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C
- molecular weight:
- 629.941
- inchi key:
- InChIKey=LIEYLSGXGOXYTD-CTBYCIIYSA-M
- common name:
- 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate
- Synonym(s):
- 3-(3,7,11,15,19,23-heptamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
- 3-heptaprenyl-4,5-dihydroxybenzoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C" cannot be used as a page name in this wiki.
