Difference between revisions of "CPD-19170"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6482 PWY-6482] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6482 PWY-6482] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* molecular weight:
 +
** 997.883   
 +
* inchi key:
 +
** InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J
 
* common name:
 
* common name:
** diphthamide biosynthesis (archaea)
+
** (2E,7Z)-hexadecenoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** 16:2-Δ2,Δ7-CoA
 +
** 2-trans,7-cis-hexadecenoyl-CoA
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''2''' reaction(s) found
+
* [[RXN-17780]]
** [[RXN-14326]]
+
== Reaction(s) known to produce the compound ==
** [[DIPHTINE--AMMONIA-LIGASE-RXN]]
+
* [[RXN-17779]]
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
* '''1''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11371 RXN-11371]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2157}}
+
{{#set: smiles=CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: common name=diphthamide biosynthesis (archaea)}}
+
{{#set: molecular weight=997.883    }}
{{#set: reaction found=2}}
+
{{#set: inchi key=InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J}}
{{#set: reaction not found=1}}
+
{{#set: common name=(2E,7Z)-hexadecenoyl-CoA}}
 +
{{#set: common name=16:2-Δ2,Δ7-CoA|2-trans,7-cis-hexadecenoyl-CoA}}
 +
{{#set: consumed by=RXN-17780}}
 +
{{#set: produced by=RXN-17779}}

Latest revision as of 16:48, 9 January 2019

Metabolite CPD-19170

  • smiles:
    • CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 997.883
  • inchi key:
    • InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J
  • common name:
    • (2E,7Z)-hexadecenoyl-CoA
  • Synonym(s):
    • 16:2-Δ2,Δ7-CoA
    • 2-trans,7-cis-hexadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.