Difference between revisions of "CPD-17045"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5242 RXN-5242] == * direction: ** LEFT-TO-RIGHT * common name: ** ent-kaurenol 19-dehydrogenase...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5242 RXN-5242] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
 +
* molecular weight:
 +
** 266.253   
 +
* inchi key:
 +
** InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
 
* common name:
 
* common name:
** ent-kaurenol 19-dehydrogenase
+
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
 +
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-15680]]
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[ENT-KAUR-16-EN-19-OL]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[ENT-KAUR-16-EN-19-AL]][c] '''+''' 2 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 oxygen[c] '''+''' 1 ent-kaurenol[c] '''=>''' 1 NADP+[c] '''+''' 1 ent-kaurenal[c] '''+''' 2 H2O[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00008616001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00009131001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00008672001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00010245001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00009499001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00008813001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00009062001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00010004001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00008663001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
== Pathways  ==
+
* [[PWY-5047]], gibberellin biosynthesis IV (Gibberella fujikuroi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5047 PWY-5047]
+
** '''3''' reactions found over '''15''' reactions in the full pathway
+
* [[PWY-5034]], GA12 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034]
+
** '''3''' reactions found over '''6''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R06292 R06292]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659074 90659074]
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)}}
{{#set: common name=ent-kaurenol 19-dehydrogenase}}
+
{{#set: molecular weight=266.253    }}
{{#set: gene associated=CHC_T00008616001_1|CHC_T00009131001_1|CHC_T00008672001_1|CHC_T00010245001_1|CHC_T00009499001_1|CHC_T00008813001_1|CHC_T00009062001_1|CHC_T00010004001_1|CHC_T00008663001_1}}
+
{{#set: inchi key=InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N}}
{{#set: in pathway=PWY-5047|PWY-5034}}
+
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
{{#set: reconstruction category=orthology}}
+
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP|3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN-15680}}
{{#set: reconstruction source=a.taliana}}
+

Latest revision as of 15:49, 9 January 2019

Metabolite CPD-17045

  • smiles:
    • C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
  • molecular weight:
    • 266.253
  • inchi key:
    • InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
  • common name:
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
  • Synonym(s):
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links