Difference between revisions of "DIHYDROKAEMPFEROL-CMPD"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008374001_1 == * Synonym(s): == Reactions associated == * 3-DEHYDROSPHINGANINE-REDUCTASE-RXN ** pantograph-galdieria.sulphuraria...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROKAEMPFEROL-CMPD DIHYDROKAEMPFEROL-CMPD] == |
| + | * smiles: | ||
| + | ** C1(=C(C=CC(=C1)O)C2(OC3(C(C(C2O)=O)=C(O)C=C(O)C=3))) | ||
| + | * molecular weight: | ||
| + | ** 288.256 | ||
| + | * inchi key: | ||
| + | ** InChIKey=PADQINQHPQKXNL-LSDHHAIUSA-N | ||
| + | * common name: | ||
| + | ** (+)-dihydrokaempferol | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (+)-aromadendrin | ||
| + | ** (2R,3R)-dihydrokaempferol | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15401 15401] |
| + | * CAS : 480-20-6 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=122850 122850] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00974 C00974] | ||
| + | * METABOLIGHTS : MTBLC15401 | ||
| + | {{#set: smiles=C1(=C(C=CC(=C1)O)C2(OC3(C(C(C2O)=O)=C(O)C=C(O)C=3)))}} | ||
| + | {{#set: molecular weight=288.256 }} | ||
| + | {{#set: inchi key=InChIKey=PADQINQHPQKXNL-LSDHHAIUSA-N}} | ||
| + | {{#set: common name=(+)-dihydrokaempferol}} | ||
| + | {{#set: common name=(+)-aromadendrin|(2R,3R)-dihydrokaempferol}} | ||
| + | {{#set: consumed by=DIHYDROKAEMPFEROL-4-REDUCTASE-RXN}} | ||
Latest revision as of 15:49, 9 January 2019
Contents
Metabolite DIHYDROKAEMPFEROL-CMPD
- smiles:
- C1(=C(C=CC(=C1)O)C2(OC3(C(C(C2O)=O)=C(O)C=C(O)C=3)))
- molecular weight:
- 288.256
- inchi key:
- InChIKey=PADQINQHPQKXNL-LSDHHAIUSA-N
- common name:
- (+)-dihydrokaempferol
- Synonym(s):
- (+)-aromadendrin
- (2R,3R)-dihydrokaempferol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
