Difference between revisions of "RXN-7658"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C * inchi key: ** InCh...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7658 RXN-7658] ==
−
* smiles:
+
* direction:
−
** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M
+
−
* common name:
+
−
** pristanate
+
−
* molecular weight:
+
−
** 297.5   
+
 
* Synonym(s):
 
* Synonym(s):
−
** pristanic-acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-484]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-7002]][c] '''+''' 1 [[NADP]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[GERANYLGERANYL-PP]][c] '''+''' 1 [[NADPH]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 dihydrogeranylgeranyl diphosphate[c] '''+''' 1 NADP+[c] '''<=>''' 1 H+[c] '''+''' 1 geranylgeranyl diphosphate[c] '''+''' 1 NADPH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009478001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5063]], phytyl diphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5063 PWY-5063]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20849056 20849056]
+
** [http://www.genome.jp/dbget-bin/www_bget?R08754 R08754]
−
* CHEMSPIDER:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.chemspider.com/Chemical-Structure.20171482.html 20171482]
+
{{#set: gene associated=CHC_T00009478001_1}}
−
* CHEBI:
+
{{#set: in pathway=PWY-5063}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77268 77268]
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}}
−
{{#set: inchi key=InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=pristanate}}
+
−
{{#set: molecular weight=297.5    }}
+
−
{{#set: common name=pristanic-acid}}
+
−
{{#set: consumed by=RXN66-484}}
+

Latest revision as of 15:45, 9 January 2019

Reaction RXN-7658

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 dihydrogeranylgeranyl diphosphate[c] + 1 NADP+[c] <=> 1 H+[c] + 1 geranylgeranyl diphosphate[c] + 1 NADPH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5063, phytyl diphosphate biosynthesis: PWY-5063
    • 3 reactions found over 3 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-7658&oldid=20765"