Difference between revisions of "CPD-7109"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P161-PWY P161-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C |
| + | * molecular weight: | ||
| + | ** 277.339 | ||
| + | * inchi key: | ||
| + | ** InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-prenylphlorisovalerophenone |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** PPIVP |
| + | ** compound-X | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-7810]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-7811]] | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200610 25200610] |
| − | {{#set: common name= | + | {{#set: smiles=CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C}} |
| − | {{#set: common name= | + | {{#set: molecular weight=277.339 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: common name=4-prenylphlorisovalerophenone}} |
| + | {{#set: common name=PPIVP|compound-X}} | ||
| + | {{#set: consumed by=RXN-7810}} | ||
| + | {{#set: produced by=RXN-7811}} | ||
Latest revision as of 15:12, 9 January 2019
Contents
Metabolite CPD-7109
- smiles:
- CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C
- molecular weight:
- 277.339
- inchi key:
- InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M
- common name:
- 4-prenylphlorisovalerophenone
- Synonym(s):
- PPIVP
- compound-X
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C" cannot be used as a page name in this wiki.
