Difference between revisions of "CHC T00001989001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene CHC_T00001989001_1 == * Synonym(s): == Reactions associated == * Reaction: 3.4.21.89-RXN ** Source: orthology-galdieria.sulphuraria == Pathw...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00001989001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.4.21.89-RXN]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | * [[ | + | == Pathways associated == |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3.4.21.89-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 16:18, 23 May 2018
Gene CHC_T00001989001_1
- Synonym(s):
Reactions associated
- Reaction: 3.4.21.89-RXN
- Source: orthology-galdieria.sulphuraria