Difference between revisions of "CPD-12115"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00004489001_1 == * Synonym(s): == Reactions associated == * ANTHRANSYN-RXN ** pantograph-galdieria.sulphuraria == Pathways associat...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12115 CPD-12115] == |
| + | * smiles: | ||
| + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)) | ||
| + | * molecular weight: | ||
| + | ** 705.118 | ||
| + | * inchi key: | ||
| + | ** InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N | ||
| + | * common name: | ||
| + | ** demethylmenaquinol-8 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 2-demethylmenaquinol-8 | ||
| + | ** DMKH2-8 | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[ADOMET-DMK-METHYLTRANSFER-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61873 61873] |
| + | * BIGG : 2dmmql8 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479277 45479277] | ||
| + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2))}} | ||
| + | {{#set: molecular weight=705.118 }} | ||
| + | {{#set: inchi key=InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N}} | ||
| + | {{#set: common name=demethylmenaquinol-8}} | ||
| + | {{#set: common name=2-demethylmenaquinol-8|DMKH2-8}} | ||
| + | {{#set: consumed by=ADOMET-DMK-METHYLTRANSFER-RXN}} | ||
Latest revision as of 15:51, 9 January 2019
Contents
Metabolite CPD-12115
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2))
- molecular weight:
- 705.118
- inchi key:
- InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N
- common name:
- demethylmenaquinol-8
- Synonym(s):
- 2-demethylmenaquinol-8
- DMKH2-8
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
