Difference between revisions of "CPD0-1163"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00010194001 == * left end position: ** 106245 * transcription direction: ** NEGATIVE * right end position: ** 106568 * centisome position: ** 68...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00010194001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] ==
* left end position:
+
* smiles:
** 106245
+
** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
* transcription direction:
+
* molecular weight:
** NEGATIVE
+
** 987.845   
* right end position:
+
* inchi key:
** 106568
+
** InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J
* centisome position:
+
* common name:
** 68.18576   
+
** (S)-3-hydroxy-(5Z)-tetradecenoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** (S)-3-hydroxy-5-cis-tetradecenoyl-CoA
 +
** (S)-3-hydroxy-14:1-Δ5-CoA
 +
** (3S)-hydroxy-5-cis-tetradecenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ATPSYN-RXN]]
+
== Reaction(s) known to produce the compound ==
** original_genome
+
* [[RXN0-5393]]
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-7219]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=106245}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244729 25244729]
{{#set: right end position=106568}}
+
{{#set: smiles=CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
{{#set: centisome position=68.18576    }}
+
{{#set: molecular weight=987.845    }}
{{#set: reaction associated=ATPSYN-RXN}}
+
{{#set: inchi key=InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J}}
{{#set: pathway associated=PWY-7219}}
+
{{#set: common name=(S)-3-hydroxy-(5Z)-tetradecenoyl-CoA}}
 +
{{#set: common name=(S)-3-hydroxy-5-cis-tetradecenoyl-CoA|(S)-3-hydroxy-14:1-Δ5-CoA|(3S)-hydroxy-5-cis-tetradecenoyl-CoA}}
 +
{{#set: produced by=RXN0-5393}}

Latest revision as of 15:53, 9 January 2019

Metabolite CPD0-1163

  • smiles:
    • CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
  • molecular weight:
    • 987.845
  • inchi key:
    • InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J
  • common name:
    • (S)-3-hydroxy-(5Z)-tetradecenoyl-CoA
  • Synonym(s):
    • (S)-3-hydroxy-5-cis-tetradecenoyl-CoA
    • (S)-3-hydroxy-14:1-Δ5-CoA
    • (3S)-hydroxy-5-cis-tetradecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.