Difference between revisions of "PWY-7492"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] == * smiles: ** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7492 PWY-7492] ==
* smiles:
+
** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))
+
* inchi key:
+
** InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K
+
 
* common name:
 
* common name:
** FAD
+
** paspaline biosynthesis
* molecular weight:
+
* taxonomic range:
** 782.533   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* Synonym(s):
 
* Synonym(s):
** flavin adenine dinucleotide oxidized
 
** flavin adenine dinucleotide
 
** flavitan
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''6''' reactions in the full pathway
* [[FADSYN-RXN]]
+
* [[FARNESYLTRANSTRANSFERASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
* [[RXN-14264]]
+
*** [[CHC_T00006851001_1]]
 +
*** [[CHC_T00004833001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15494 RXN-15494]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15495 RXN-15495]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15496 RXN-15496]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15497 RXN-15497]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15498 RXN-15498]
 
== External links  ==
 
== External links  ==
* CAS : 146-14-5
+
* LIGAND-MAP:
* Wikipedia : Flavin_adenine_dinucleotide
+
** [http://www.genome.jp/dbget-bin/www_bget?map00403 map00403]
* PUBCHEM:
+
{{#set: common name=paspaline biosynthesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906035 46906035]
+
{{#set: taxonomic range=TAX-4751}}
* HMDB : HMDB01248
+
{{#set: reaction found=1}}
* LIGAND-CPD:
+
{{#set: total reaction=6}}
** [http://www.genome.jp/dbget-bin/www_bget?C00016 C00016]
+
{{#set: completion rate=17.0}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.13082029.html 13082029]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57692 57692]
+
* BIGG : fad
+
{{#set: smiles=CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))}}
+
{{#set: inchi key=InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K}}
+
{{#set: common name=FAD}}
+
{{#set: molecular weight=782.533    }}
+
{{#set: common name=flavin adenine dinucleotide oxidized|flavin adenine dinucleotide|flavitan}}
+
{{#set: produced by=FADSYN-RXN}}
+
{{#set: consumed or produced by=RXN-14264}}
+

Latest revision as of 15:12, 9 January 2019

Pathway PWY-7492

  • common name:
    • paspaline biosynthesis
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links