Difference between revisions of "RXN-13162"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11937 CPD-11937] == * smiles: ** C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-]...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11937 CPD-11937] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13162 RXN-13162] ==
* smiles:
+
* direction:
** C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B
+
** [http://enzyme.expasy.org/EC/2.5.1.21 EC-2.5.1.21]
* common name:
+
** 1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
+
* molecular weight:
+
** 727.921   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-PP-InsP5
 
** 3-diphospho-1D-myo-inositol pentakisphosphate
 
** 3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10973]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 2 [[FARNESYL-PP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''=>''' 2 [[PPI]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[SQUALENE]][c]
* [[RXN-10971]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 2 (2E,6E)-farnesyl diphosphate[c] '''+''' 1 H+[c] '''+''' 1 NAD(P)H[c] '''=>''' 2 diphosphate[c] '''+''' 1 NAD(P)+[c] '''+''' 1 squalene[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00001581001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5670]], epoxysqualene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5670 PWY-5670]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173206 46173206]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32302 32302]
{{#set: smiles=C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)}}
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32296 32296]
{{#set: inchi key=InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B}}
+
* LIGAND-RXN:
{{#set: common name=1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R06223 R06223]
{{#set: molecular weight=727.921    }}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: common name=3-PP-InsP5|3-diphospho-1D-myo-inositol pentakisphosphate|3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate}}
+
{{#set: ec number=EC-2.5.1.21}}
{{#set: consumed by=RXN-10973}}
+
{{#set: gene associated=CHC_T00001581001_1}}
{{#set: produced by=RXN-10971}}
+
{{#set: in pathway=PWY-5670}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 15:52, 9 January 2019

Reaction RXN-13162

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5670, epoxysqualene biosynthesis: PWY-5670
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links