Difference between revisions of "PWY-5064"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C([N+])C...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5064 PWY-5064] ==
* smiles:
+
** C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)
+
* inchi key:
+
** InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M
+
 
* common name:
 
* common name:
** 4-amino-4-deoxychorismate
+
** chlorophyll a biosynthesis II
* molecular weight:
+
* taxonomic range:
** 224.193   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[RXN-5286]]
* [[ADCLY-RXN]]
+
** 0 associated gene:
* [[PABASYN-RXN]]
+
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-7663]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00008377001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN-7664]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009478001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-7665]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009478001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-7666]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009478001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* CAS : 97279-79-3
+
* ARACYC:
* PUBCHEM:
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5064 PWY-5064]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266632 45266632]
+
{{#set: common name=chlorophyll a biosynthesis II}}
* CHEBI:
+
{{#set: taxonomic range=TAX-33090}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58406 58406]
+
{{#set: reaction found=5}}
* BIGG : 4adcho
+
{{#set: total reaction=5}}
* LIGAND-CPD:
+
{{#set: completion rate=100.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C11355 C11355]
+
{{#set: smiles=C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)}}
+
{{#set: inchi key=InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M}}
+
{{#set: common name=4-amino-4-deoxychorismate}}
+
{{#set: molecular weight=224.193    }}
+
{{#set: consumed or produced by=ADCLY-RXN|PABASYN-RXN}}
+

Latest revision as of 15:13, 9 January 2019

Pathway PWY-5064

  • common name:
    • chlorophyll a biosynthesis II
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links