Difference between revisions of "CPD-11937"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5640 PWY-5640] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5640 PWY-5640] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11937 CPD-11937] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)
 +
* molecular weight:
 +
** 727.921   
 +
* inchi key:
 +
** InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B
 
* common name:
 
* common name:
** nitrobenzene degradation II
+
** 1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-PP-InsP5
 +
** 3-diphospho-1D-myo-inositol pentakisphosphate
 +
** 3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''1''' reaction(s) found
+
* [[RXN-10973]]
** [[RXN-3661]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) not found ==
+
* [[RXN-10971]]
* '''0''' reaction(s) not found
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* UM-BBD-PWY : nb
+
* PUBCHEM:
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173206 46173206]
{{#set: common name=nitrobenzene degradation II}}
+
{{#set: smiles=C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)}}
{{#set: reaction found=1}}
+
{{#set: molecular weight=727.921    }}
{{#set: reaction not found=0}}
+
{{#set: inchi key=InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B}}
 +
{{#set: common name=1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate}}
 +
{{#set: common name=3-PP-InsP5|3-diphospho-1D-myo-inositol pentakisphosphate|3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate}}
 +
{{#set: consumed by=RXN-10973}}
 +
{{#set: produced by=RXN-10971}}

Latest revision as of 15:57, 9 January 2019

Metabolite CPD-11937

  • smiles:
    • C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)
  • molecular weight:
    • 727.921
  • inchi key:
    • InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B
  • common name:
    • 1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
  • Synonym(s):
    • 3-PP-InsP5
    • 3-diphospho-1D-myo-inositol pentakisphosphate
    • 3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)" cannot be used as a page name in this wiki.