Difference between revisions of "CPD-11937"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5640 PWY-5640] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11937 CPD-11937] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1) |
| + | * molecular weight: | ||
| + | ** 727.921 | ||
| + | * inchi key: | ||
| + | ** InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B | ||
* common name: | * common name: | ||
| − | ** | + | ** 1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-PP-InsP5 | ||
| + | ** 3-diphospho-1D-myo-inositol pentakisphosphate | ||
| + | ** 3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-10973]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-10971]] |
| − | * | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173206 46173206] |
| − | {{#set: common name= | + | {{#set: smiles=C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)}} |
| − | {{#set: | + | {{#set: molecular weight=727.921 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B}} |
| + | {{#set: common name=1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate}} | ||
| + | {{#set: common name=3-PP-InsP5|3-diphospho-1D-myo-inositol pentakisphosphate|3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate}} | ||
| + | {{#set: consumed by=RXN-10973}} | ||
| + | {{#set: produced by=RXN-10971}} | ||
Latest revision as of 15:57, 9 January 2019
Contents
Metabolite CPD-11937
- smiles:
- C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)
- molecular weight:
- 727.921
- inchi key:
- InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B
- common name:
- 1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
- Synonym(s):
- 3-PP-InsP5
- 3-diphospho-1D-myo-inositol pentakisphosphate
- 3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)" cannot be used as a page name in this wiki.
