Difference between revisions of "RXN-13603"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4577 CPD-4577] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13603 RXN-13603] == * direction: ** LEFT-TO-RIGHT * common name: ** neolinustatin β-digluc...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4577 CPD-4577] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13603 RXN-13603] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M
+
 
* common name:
 
* common name:
−
** 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol
+
** neolinustatin β-diglucosidase
−
* molecular weight:
+
* ec number:
−
** 441.673   
+
** [http://enzyme.expasy.org/EC/3.2.1.21 EC-3.2.1.21]
 
* Synonym(s):
 
* Synonym(s):
−
** 4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol
 
−
** 4β-methylzymosterol-4α-carboxylate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-313]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-14596]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-10277]][c] '''+''' 1 [[Glucopyranose]][c]
−
* [[RXN-13712]]
+
* With common name(s):
−
* [[RXN66-312]]
+
** 1 neolinustatin[c] '''+''' 1 H2O[c] '''=>''' 1 lotaustralin[c] '''+''' 1 D-glucopyranose[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009011001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00009266001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7092]], neolinustatin bioactivation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7092 PWY-7092]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339293 57339293]
+
{{#set: common name=neolinustatin β-diglucosidase}}
−
* CHEBI:
+
{{#set: ec number=EC-3.2.1.21}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64925 64925]
+
{{#set: gene associated=CHC_T00009011001_1|CHC_T00009266001_1}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7092}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15808 C15808]
+
{{#set: reconstruction category=orthology}}
−
* HMDB : HMDB06927
+
{{#set: reconstruction source=orthology-ectocarpus_siliculosus}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M}}
+
−
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol}}
+
−
{{#set: molecular weight=441.673    }}
+
−
{{#set: common name=4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol|4β-methylzymosterol-4α-carboxylate}}
+
−
{{#set: consumed by=RXN66-313}}
+
−
{{#set: produced by=RXN-13712|RXN66-312}}
+

Latest revision as of 15:23, 23 May 2018

Reaction RXN-13603

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • neolinustatin β-diglucosidase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 neolinustatin[c] + 1 H2O[c] => 1 lotaustralin[c] + 1 D-glucopyranose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7092, neolinustatin bioactivation: PWY-7092
    • 2 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-13603&oldid=14199"