Difference between revisions of "CPD-7414"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00004793001_1 == * Synonym(s): == Reactions associated == * RXN-8443 ** pantograph-a.taliana == Pathways associated == * PWY-5381...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00004793001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] ==
 +
* smiles:
 +
** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)
 +
* molecular weight:
 +
** 536.882   
 +
* inchi key:
 +
** InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N
 +
* common name:
 +
** ε-carotene
 
* Synonym(s):
 
* Synonym(s):
 +
** ε,ε-carotene
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-8443]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[a.taliana]]
+
* [[RXN-8028]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-5381]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-8443}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-5381}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12358808 12358808]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C16276 C16276]
 +
{{#set: smiles=CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)}}
 +
{{#set: molecular weight=536.882    }}
 +
{{#set: inchi key=InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N}}
 +
{{#set: common name=ε-carotene}}
 +
{{#set: common name=ε,ε-carotene}}
 +
{{#set: produced by=RXN-8028}}

Latest revision as of 15:58, 9 January 2019

Metabolite CPD-7414

  • smiles:
    • CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)
  • molecular weight:
    • 536.882
  • inchi key:
    • InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N
  • common name:
    • ε-carotene
  • Synonym(s):
    • ε,ε-carotene

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links