Difference between revisions of "CPD-4577"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7337 PWY-7337] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4577 CPD-4577] == |
− | * | + | * smiles: |
− | ** [ | + | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34)))) |
+ | * molecular weight: | ||
+ | ** 441.673 | ||
+ | * inchi key: | ||
+ | ** InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol |
* Synonym(s): | * Synonym(s): | ||
+ | ** 4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol | ||
+ | ** 4β-methylzymosterol-4α-carboxylate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN66-313]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-13712]] | |
− | + | * [[RXN66-312]] | |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64925 64925] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339293 57339293] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15808 C15808] | ||
+ | * HMDB : HMDB06927 | ||
+ | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))}} | ||
+ | {{#set: molecular weight=441.673 }} | ||
+ | {{#set: inchi key=InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M}} | ||
+ | {{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol}} | ||
+ | {{#set: common name=4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol|4β-methylzymosterol-4α-carboxylate}} | ||
+ | {{#set: consumed by=RXN66-313}} | ||
+ | {{#set: produced by=RXN-13712|RXN66-312}} |
Latest revision as of 15:59, 9 January 2019
Contents
Metabolite CPD-4577
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))
- molecular weight:
- 441.673
- inchi key:
- InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M
- common name:
- 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol
- Synonym(s):
- 4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol
- 4β-methylzymosterol-4α-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.