Difference between revisions of "CHC T00008769001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASCORBATE ASCORBATE] == * smiles: ** C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene CHC_T00008769001_1 == * Synonym(s): == Reactions associated == * Reaction: 3.6.4.4-RXN ** Source: orthology-ectocarpus_siliculosus == Pathwa...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008769001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * | + | * Reaction: [[3.6.4.4-RXN]] |
− | + | ** Source: [[orthology-ectocarpus_siliculosus]] | |
− | + | == Pathways associated == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3.6.4.4-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 15:24, 23 May 2018
Gene CHC_T00008769001_1
- Synonym(s):
Reactions associated
- Reaction: 3.6.4.4-RXN
- Source: orthology-ectocarpus_siliculosus