Difference between revisions of "CPD-706"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYLMETHIONINAMINE S-ADENOSYLMETHIONINAMINE] == * smiles: ** C[S+](CCC[N+])CC1(OC(C(O)C(O...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == |
* smiles: | * smiles: | ||
− | ** C[ | + | ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
+ | * molecular weight: | ||
+ | ** 398.671 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N |
* common name: | * common name: | ||
− | ** | + | ** 24-methylenecholesterol |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-4222]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-707]] |
+ | * [[extended_2.1.1.143-RXN_CPD-707]] | ||
+ | * [[extended_2.1.1.143-RXN_DESMOSTEROL-CPD]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92113 92113] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15781 C15781] |
− | * | + | * HMDB : HMDB06849 |
− | + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | |
− | + | {{#set: molecular weight=398.671 }} | |
− | {{#set: smiles=C[ | + | {{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}} |
− | + | {{#set: common name=24-methylenecholesterol}} | |
− | + | {{#set: consumed by=RXN-4222}} | |
− | {{#set: molecular weight= | + | {{#set: produced by=RXN-707|extended_2.1.1.143-RXN_CPD-707|extended_2.1.1.143-RXN_DESMOSTEROL-CPD}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 15:59, 9 January 2019
Contents
Metabolite CPD-706
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- molecular weight:
- 398.671
- inchi key:
- InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
- common name:
- 24-methylenecholesterol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.