Difference between revisions of "CPD-19169"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00010224001 == * left end position: ** 134295 * transcription direction: ** POSITIVE * right end position: ** 136346 * centisome position: ** 48...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00010224001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] ==
* left end position:
+
* smiles:
** 134295
+
** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* molecular weight:
** POSITIVE
+
** 1041.936   
* right end position:
+
* inchi key:
** 136346
+
** InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J
* centisome position:
+
* common name:
** 48.115955   
+
** 3-oxo-(9Z)-octadecenoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-18:1-Δ9-CoA
 +
** 3-oxo-9-cis-octadecenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN0-4261]]
+
* [[RXN-17778]]
** original_genome
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
* [[RXN-17777]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: left end position=134295}}
+
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: transcription direction=POSITIVE}}
+
{{#set: molecular weight=1041.936    }}
{{#set: right end position=136346}}
+
{{#set: inchi key=InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J}}
{{#set: centisome position=48.115955    }}
+
{{#set: common name=3-oxo-(9Z)-octadecenoyl-CoA}}
{{#set: reaction associated=RXN0-4261}}
+
{{#set: common name=3-oxo-18:1-Δ9-CoA|3-oxo-9-cis-octadecenoyl-CoA}}
 +
{{#set: consumed by=RXN-17778}}
 +
{{#set: produced by=RXN-17777}}

Latest revision as of 16:01, 9 January 2019

Metabolite CPD-19169

  • smiles:
    • CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 1041.936
  • inchi key:
    • InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J
  • common name:
    • 3-oxo-(9Z)-octadecenoyl-CoA
  • Synonym(s):
    • 3-oxo-18:1-Δ9-CoA
    • 3-oxo-9-cis-octadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.