Difference between revisions of "5-OXOPROLINE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00006889001_1 == * Synonym(s): == Reactions associated == * RXN-8443 ** pantograph-a.taliana == Pathways associated == * PWY-5381...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-OXOPROLINE 5-OXOPROLINE] == |
| + | * smiles: | ||
| + | ** C(=O)(C1(NC(CC1)=O))[O-] | ||
| + | * molecular weight: | ||
| + | ** 128.107 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ODHCTXKNWHHXJC-VKHMYHEASA-M | ||
| + | * common name: | ||
| + | ** 5-oxo-L-proline | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** pyrrolidone-COO | ||
| + | ** pyrrolidone-carboxylate | ||
| + | ** L-5-pyrrolidone-2-carboxylic acid | ||
| + | ** L-pyroglutamic acid | ||
| + | ** 5-oxo-L-proline | ||
| + | ** pyroglutamic acid | ||
| + | ** pyroglutamate | ||
| + | ** 5-pyrrolidone-2-carboxylic acid | ||
| + | ** L-pyroglutamate | ||
| + | ** Pidolic acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 98-79-3 |
| − | {{#set: | + | * HMDB : HMDB00267 |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4451146.html 4451146] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58402 58402] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01879 C01879] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5289118 5289118] | ||
| + | {{#set: smiles=C(=O)(C1(NC(CC1)=O))[O-]}} | ||
| + | {{#set: molecular weight=128.107 }} | ||
| + | {{#set: inchi key=InChIKey=ODHCTXKNWHHXJC-VKHMYHEASA-M}} | ||
| + | {{#set: common name=5-oxo-L-proline}} | ||
| + | {{#set: common name=pyrrolidone-COO|pyrrolidone-carboxylate|L-5-pyrrolidone-2-carboxylic acid|L-pyroglutamic acid|5-oxo-L-proline|pyroglutamic acid|pyroglutamate|5-pyrrolidone-2-carboxylic acid|L-pyroglutamate|Pidolic acid}} | ||
| + | {{#set: consumed by=5-OXOPROLINASE-ATP-HYDROLYSING-RXN}} | ||
| + | {{#set: produced by=GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN}} | ||
Latest revision as of 16:01, 9 January 2019
Contents
Metabolite 5-OXOPROLINE
- smiles:
- C(=O)(C1(NC(CC1)=O))[O-]
- molecular weight:
- 128.107
- inchi key:
- InChIKey=ODHCTXKNWHHXJC-VKHMYHEASA-M
- common name:
- 5-oxo-L-proline
- Synonym(s):
- pyrrolidone-COO
- pyrrolidone-carboxylate
- L-5-pyrrolidone-2-carboxylic acid
- L-pyroglutamic acid
- 5-oxo-L-proline
- pyroglutamic acid
- pyroglutamate
- 5-pyrrolidone-2-carboxylic acid
- L-pyroglutamate
- Pidolic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)(C1(NC(CC1)=O))[O-" cannot be used as a page name in this wiki.
