Difference between revisions of "GLUTSYNIII-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == * smiles: ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2)) * inchi key...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUTSYNIII-PWY GLUTSYNIII-PWY] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-glutamate biosynthesis III |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''1''' reactions in the full pathway |
| − | + | * [[GLUTDEHYD-RXN]] | |
| − | * [[ | + | ** 2 associated gene(s): |
| − | == Reaction(s) | + | *** [[CHC_T00010235001]] |
| + | *** [[CHC_T00010235001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=GLUTSYNIII-PWY GLUTSYNIII-PWY] |
| − | + | {{#set: common name=L-glutamate biosynthesis III}} | |
| − | + | {{#set: taxonomic range=TAX-33154}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=1}} | |
| − | {{#set: | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:51, 9 January 2019
Pathway GLUTSYNIII-PWY
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- GLUTDEHYD-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
