Difference between revisions of "PHOSPHORIBOSYL-ATP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) * inchi ke...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-ATP PHOSPHORIBOSYL-ATP] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O |
+ | * molecular weight: | ||
+ | ** 714.24 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=RKNHJBVBFHDXGR-KEOHHSTQSA-I |
* common name: | * common name: | ||
− | ** ( | + | ** 1-(5-phospho-β-D-ribosyl)-ATP |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 1-(5-phosphoribosyl)-ATP | ||
+ | ** N1-(5-phospho-D-ribosyl)-ATP | ||
+ | ** 5-phosphoribosyl-ATP | ||
+ | ** 1-(5-phospho-D-ribosyl)-ATP | ||
+ | ** phosphoribosyl-ATP | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[HISTPRATPHYD-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[ATPPHOSPHORIBOSYLTRANS-RXN]] | ||
== External links == | == External links == | ||
− | * | + | * BIGG : prbatp |
− | + | ||
− | + | ||
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02739 C02739] |
+ | * HMDB : HMDB03665 | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73200 73200] |
− | * | + | * DRUGBANK : DB01661 |
− | {{#set: smiles= | + | * PUBCHEM: |
− | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658853 90658853] |
− | {{#set: common name=( | + | {{#set: smiles=C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O}} |
− | {{#set: | + | {{#set: molecular weight=714.24 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=RKNHJBVBFHDXGR-KEOHHSTQSA-I}} |
+ | {{#set: common name=1-(5-phospho-β-D-ribosyl)-ATP}} | ||
+ | {{#set: common name=1-(5-phosphoribosyl)-ATP|N1-(5-phospho-D-ribosyl)-ATP|5-phosphoribosyl-ATP|1-(5-phospho-D-ribosyl)-ATP|phosphoribosyl-ATP}} | ||
+ | {{#set: consumed by=HISTPRATPHYD-RXN}} | ||
+ | {{#set: reversible reaction associated=ATPPHOSPHORIBOSYLTRANS-RXN}} |
Latest revision as of 16:02, 9 January 2019
Contents
Metabolite PHOSPHORIBOSYL-ATP
- smiles:
- C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O
- molecular weight:
- 714.24
- inchi key:
- InChIKey=RKNHJBVBFHDXGR-KEOHHSTQSA-I
- common name:
- 1-(5-phospho-β-D-ribosyl)-ATP
- Synonym(s):
- 1-(5-phosphoribosyl)-ATP
- N1-(5-phospho-D-ribosyl)-ATP
- 5-phosphoribosyl-ATP
- 1-(5-phospho-D-ribosyl)-ATP
- phosphoribosyl-ATP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.