Difference between revisions of "CHC T00007253001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAMP CAMP] == * smiles: ** C1(OP(=O)([O-])OC2(C(O)C(OC12)N4(C=NC3(C(N)=NC=NC=34)))) * inchi key...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00007253001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[UROGENIIISYN-RXN]] | |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | == | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
+ | == Pathways associated == | ||
+ | * [[PWY-5188]] | ||
+ | * [[PWY-5189]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=UROGENIIISYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-5188|PWY-5189}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 15:50, 9 January 2019
Gene CHC_T00007253001_1
- Synonym(s):
Reactions associated
- Reaction: UROGENIIISYN-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus