Difference between revisions of "NONOXIPENT-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1414 CPD0-1414] == * smiles: ** CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1414 CPD0-1414] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=NONOXIPENT-PWY NONOXIPENT-PWY] ==
* smiles:
+
** CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+](C)C)[CH](C[CH]12)3)))=C(O)C=CC=4))
+
* inchi key:
+
** InChIKey=OFVLGDICTFRJMM-WESIUVDSSA-N
+
 
* common name:
 
* common name:
** tetracycline
+
** pentose phosphate pathway (non-oxidative branch)
* molecular weight:
+
* taxonomic range:
** 444.44   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[TRANS-RXN1HP7-17]]
+
'''5''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[1TRANSKETO-RXN]]
* [[TRANS-RXN1HP7-17]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00009390001_1]]
 +
*** [[CHC_T00005040001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[2TRANSKETO-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00005040001_1]]
 +
*** [[CHC_T00009390001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RIB5PISOM-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009264001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RIBULP3EPIM-RXN]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00008270001_1]]
 +
*** [[CHC_T00006121001_1]]
 +
*** [[CHC_T00008270001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[TRANSALDOL-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00000120001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=27885548 27885548]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=NONOXIPENT-PWY NONOXIPENT-PWY]
* CHEBI:
+
{{#set: common name=pentose phosphate pathway (non-oxidative branch)}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71392 71392]
+
{{#set: taxonomic range=TAX-2759}}
{{#set: smiles=CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+](C)C)[CH](C[CH]12)3)))=C(O)C=CC=4))}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: inchi key=InChIKey=OFVLGDICTFRJMM-WESIUVDSSA-N}}
+
{{#set: reaction found=5}}
{{#set: common name=tetracycline}}
+
{{#set: total reaction=5}}
{{#set: molecular weight=444.44    }}
+
{{#set: completion rate=100.0}}
{{#set: consumed by=TRANS-RXN1HP7-17}}
+
{{#set: produced by=TRANS-RXN1HP7-17}}
+

Latest revision as of 15:53, 9 January 2019

Pathway NONOXIPENT-PWY

  • common name:
    • pentose phosphate pathway (non-oxidative branch)
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links