Difference between revisions of "PYRUVDEH-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)N(C)C(=O)N2)) * inchi key: ** InChIKe...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYRUVDEH-RXN PYRUVDEH-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** pyruvate dehydrogenase E1 alpha subunit, mitochondrial precursor |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.2.1 EC-1.2.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[NAD]][c] '''+''' 1 [[PYRUVATE]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[ACETYL-COA]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] |
− | = | + | * With common name(s): |
+ | ** 1 NAD+[c] '''+''' 1 pyruvate[c] '''+''' 1 coenzyme A[c] '''=>''' 1 NADH[c] '''+''' 1 acetyl-CoA[c] '''+''' 1 CO2[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00010287001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | * Gene: [[CHC_T00008732001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | * Gene: [[CHC_T00008442001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | * Gene: [[CHC_T00008441001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | * Gene: [[CHC_T00008732001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[CHC_T00007488001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | * Gene: [[CHC_T00007380001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7384]], anaerobic energy metabolism (invertebrates, mitochondrial): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7384 PWY-7384] | ||
+ | ** '''5''' reactions found over '''12''' reactions in the full pathway | ||
+ | * [[PWY-5537]], pyruvate fermentation to acetate V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5537 PWY-5537] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[GLYCOLYSIS-TCA-GLYOX-BYPASS]], superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass: [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS-TCA-GLYOX-BYPASS GLYCOLYSIS-TCA-GLYOX-BYPASS] | ||
+ | ** '''3''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-7218]], photosynthetic 3-hydroxybutanoate biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7218 PWY-7218] | ||
+ | ** '''7''' reactions found over '''10''' reactions in the full pathway | ||
+ | * [[PWY-5482]], pyruvate fermentation to acetate II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5482 PWY-5482] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-6886]], 1-butanol autotrophic biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6886 PWY-6886] | ||
+ | ** '''8''' reactions found over '''11''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28042 28042] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00209 R00209] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=pyruvate dehydrogenase E1 alpha subunit, mitochondrial precursor}} | |
− | + | {{#set: ec number=EC-1.2.1}} | |
− | + | {{#set: gene associated=CHC_T00010287001_1|CHC_T00008732001_1|CHC_T00008442001_1|CHC_T00008441001_1|CHC_T00008732001|CHC_T00007488001_1|CHC_T00007380001_1}} | |
− | + | {{#set: in pathway=PWY-7384|PWY-5537|GLYCOLYSIS-TCA-GLYOX-BYPASS|PWY-7218|PWY-5482|PWY-6886}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-original_genome|orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 15:59, 9 January 2019
Contents
Reaction PYRUVDEH-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- pyruvate dehydrogenase E1 alpha subunit, mitochondrial precursor
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD[c] + 1 PYRUVATE[c] + 1 CO-A[c] => 1 NADH[c] + 1 ACETYL-COA[c] + 1 CARBON-DIOXIDE[c]
- With common name(s):
- 1 NAD+[c] + 1 pyruvate[c] + 1 coenzyme A[c] => 1 NADH[c] + 1 acetyl-CoA[c] + 1 CO2[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00010287001_1
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Source: orthology-arabidopsis_thaliana
- Gene: CHC_T00008732001_1
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Gene: CHC_T00008442001_1
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Gene: CHC_T00008441001_1
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Source: orthology-arabidopsis_thaliana
- Gene: CHC_T00008732001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00007488001_1
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Source: orthology-arabidopsis_thaliana
- Gene: CHC_T00007380001_1
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Source: orthology-arabidopsis_thaliana
Pathways
- PWY-7384, anaerobic energy metabolism (invertebrates, mitochondrial): PWY-7384
- 5 reactions found over 12 reactions in the full pathway
- PWY-5537, pyruvate fermentation to acetate V: PWY-5537
- 2 reactions found over 4 reactions in the full pathway
- GLYCOLYSIS-TCA-GLYOX-BYPASS, superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass: GLYCOLYSIS-TCA-GLYOX-BYPASS
- 3 reactions found over 5 reactions in the full pathway
- PWY-7218, photosynthetic 3-hydroxybutanoate biosynthesis (engineered): PWY-7218
- 7 reactions found over 10 reactions in the full pathway
- PWY-5482, pyruvate fermentation to acetate II: PWY-5482
- 1 reactions found over 3 reactions in the full pathway
- PWY-6886, 1-butanol autotrophic biosynthesis (engineered): PWY-6886
- 8 reactions found over 11 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-arabidopsis_thaliana
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-arabidopsis_thaliana
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome
External links