Difference between revisions of "ALANINE-VALINESYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-110 CPD-110] == * smiles: ** C(C1(=CC=CC=C1O))([O-])=O * inchi key: ** InChIKey=YGSDEFSMJLZ...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ALANINE-VALINESYN-PWY ALANINE-VALINESYN-PWY] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** L-alanine biosynthesis I |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
− | * [[ | + | * [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]] |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[CHC_T00003864001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ALARACECAT-RXN ALARACECAT-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=VALINE-PYRUVATE-AMINOTRANSFER-RXN VALINE-PYRUVATE-AMINOTRANSFER-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=ALANINE-VALINESYN-PWY ALANINE-VALINESYN-PWY] | |
− | + | {{#set: common name=L-alanine biosynthesis I}} | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2}} |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 16:56, 9 January 2019
Contents
Pathway ALANINE-VALINESYN-PWY
- common name:
- L-alanine biosynthesis I
- taxonomic range:
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- BRANCHED-CHAINAMINOTRANSFERVAL-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: