Difference between revisions of "PWY-7410"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] == * smiles: ** C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O * inchi key: ** InC...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7410 PWY-7410] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** ipsdienol biosynthesis |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-50557 TAX-50557] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''4''' reactions in the full pathway |
| − | + | * [[GPPSYN-RXN]] | |
| − | * [[ | + | ** 9 associated gene(s): |
| − | * [[ | + | *** [[CHC_T00005639001_1]] |
| − | == Reaction(s) | + | *** [[CHC_T00003042001_1]] |
| − | * [ | + | *** [[CHC_T00004833001_1]] |
| − | * [ | + | *** [[CHC_T00002263001_1]] |
| − | * [ | + | *** [[CHC_T00002324001_1]] |
| + | *** [[CHC_T00006851001_1]] | ||
| + | *** [[CHC_T00008377001_1]] | ||
| + | *** [[CHC_T00000930001_1]] | ||
| + | *** [[CHC_T00008265001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15039 RXN-15039] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15040 RXN-15040] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5110 RXN-5110] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=ipsdienol biosynthesis}} | |
| − | + | {{#set: taxonomic range=TAX-50557}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=25.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:56, 9 January 2019
Pathway PWY-7410
- common name:
- ipsdienol biosynthesis
- taxonomic range:
- Synonym(s):
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- GPPSYN-RXN
- 9 associated gene(s):
- 3 reconstruction source(s) associated:
