Difference between revisions of "CPD-9973"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * in...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9973 CPD-9973] == * common name: ** an [eIF5A-precursor]-deoxyhypusine * Synonym(s): ** a p...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9973 CPD-9973] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an [eIF5A-precursor]-deoxyhypusine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a protein deoxyhypusine |
| − | ** | + | ** a protein N6-(4-aminobutyl)-L-lysine |
| − | + | ** an eIF5A deoxyhypusine | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-13417]] | |
| − | * [[RXN- | + | |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[2.5.1.46-RXN]] |
== External links == | == External links == | ||
| − | + | {{#set: common name=an [eIF5A-precursor]-deoxyhypusine}} | |
| − | + | {{#set: common name=a protein deoxyhypusine|a protein N6-(4-aminobutyl)-L-lysine|an eIF5A deoxyhypusine}} | |
| − | + | {{#set: consumed by=DEOXYHYPUSINE-MONOOXYGENASE-RXN}} | |
| − | + | {{#set: produced by=RXN-13417}} | |
| − | + | {{#set: reversible reaction associated=2.5.1.46-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: produced by= | + | |
| − | {{#set: | + | |
Latest revision as of 15:00, 23 May 2018
Contents
Metabolite CPD-9973
- common name:
- an [eIF5A-precursor]-deoxyhypusine
- Synonym(s):
- a protein deoxyhypusine
- a protein N6-(4-aminobutyl)-L-lysine
- an eIF5A deoxyhypusine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an [eIF5A-precursor]-deoxyhypusine" cannot be used as a page name in this wiki.
