Difference between revisions of "PWY-6328"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-ETCETERA-L-ASPARAGINE ACETYL-ETCETERA-L-ASPARAGINE] == * smiles: ** CC(=O)NC1(C(O)C(O)C(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-ETCETERA-L-ASPARAGINE ACETYL-ETCETERA-L-ASPARAGINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6328 PWY-6328] ==
−
* smiles:
+
−
** CC(=O)NC1(C(O)C(O)C(CO)OC(NC(=O)CC([N+])C(=O)[O-])1)
+
−
* inchi key:
+
−
** InChIKey=YTTRPBWEMMPYSW-HRRFRDKFSA-N
+
 
* common name:
 
* common name:
−
** N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine
+
** L-lysine degradation X
−
* molecular weight:
+
* taxonomic range:
−
** 335.313   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 
* Synonym(s):
 
* Synonym(s):
−
** 1-β-aspartyl-N-acetyl-D-glucosaminylamine
 
−
** N4-(acetyl-β-D-glucosaminyl)asparagine
 
−
** N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[3.5.1.26-RXN]]
+
'''1''' reactions found over '''6''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[LYSDECARBOX-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00000266001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10853 RXN-10853]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10854 RXN-10854]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14724 RXN-14724]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8182 RXN-8182]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=VAGL-RXN VAGL-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=L-lysine degradation X}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201322 25201322]
+
{{#set: taxonomic range=TAX-1224}}
−
* CHEBI:
+
{{#set: reaction found=1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58080 58080]
+
{{#set: total reaction=6}}
−
* LIGAND-CPD:
+
{{#set: completion rate=17.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04540 C04540]
+
−
* HMDB : HMDB00489
+
−
{{#set: smiles=CC(=O)NC1(C(O)C(O)C(CO)OC(NC(=O)CC([N+])C(=O)[O-])1)}}
+
−
{{#set: inchi key=InChIKey=YTTRPBWEMMPYSW-HRRFRDKFSA-N}}
+
−
{{#set: common name=N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine}}
+
−
{{#set: molecular weight=335.313    }}
+
−
{{#set: common name=1-β-aspartyl-N-acetyl-D-glucosaminylamine|N4-(acetyl-β-D-glucosaminyl)asparagine|N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine}}
+
−
{{#set: consumed by=3.5.1.26-RXN}}
+

Latest revision as of 15:58, 9 January 2019

Pathway PWY-6328

  • common name:
    • L-lysine degradation X
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-6328&oldid=21071"