Difference between revisions of "1516-DIHYDROBILIVERDIN"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_95 == * left end position: ** 13582 * transcription direction: ** POSITIVE * right end position: ** 13692 * common name: ** psbY * centisome posi...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O) |
| − | * | + | * molecular weight: |
| − | ** | + | ** 582.655 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L |
* common name: | * common name: | ||
| − | ** | + | ** 15,16-dihydrobiliverdin |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[1.3.7.3-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[1.3.7.2-RXN]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57899 57899] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243901 25243901] |
| − | {{#set: | + | {{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}} |
| − | + | {{#set: molecular weight=582.655 }} | |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L}} |
| + | {{#set: common name=15,16-dihydrobiliverdin}} | ||
| + | {{#set: consumed by=1.3.7.3-RXN}} | ||
| + | {{#set: produced by=1.3.7.2-RXN}} | ||
Latest revision as of 16:09, 9 January 2019
Contents
Metabolite 1516-DIHYDROBILIVERDIN
- smiles:
- C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
- molecular weight:
- 582.655
- inchi key:
- InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
- common name:
- 15,16-dihydrobiliverdin
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.
